C25H14F3N7O4S — CID 136508580
4-[[4-[[4-cyano-1-oxo-3-(trifluoromethyl)-5H-pyrido[1,2-a]benzimidazol-2-yl]diazenyl]phenyl]diazenyl]benzenesulfonic acid (PubChem CID 136508580) has the molecular formula C25H14F3N7O4S and a molecular weight of 565.49 g/mol. Its IUPAC name is 4-[[4-[[4-cyano-1-oxo-3-(trifluoromethyl)-5H-pyrido[1,2-a]benzimidazol-2-yl]diazenyl]phenyl]diazenyl]benzenesulfonic acid.
| Compound Name | 4-[[4-[[4-cyano-1-oxo-3-(trifluoromethyl)-5H-pyrido[1,2-a]benzimidazol-2-yl]diazenyl]phenyl]diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 136508580 |
| Molecular Formula | C25H14F3N7O4S |
| Molecular Weight | 565.49 g/mol |
| Exact Mass | 565.08 |
| IUPAC Name | 4-[[4-[[4-cyano-1-oxo-3-(trifluoromethyl)-5H-pyrido[1,2-a]benzimidazol-2-yl]diazenyl]phenyl]diazenyl]benzenesulfonic acid |
| SMILES | N#Cc1c(C(F)(F)F)c(/N=N/c2ccc(/N=N/c3ccc(S(=O)(=O)O)cc3)cc2)c(=O)n2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C25H14F3N7O4S/c26-25(27,28)21-18(13-29)23-30-19-3-1-2-4-20(19)35(23)24(36)22(21)34-33-15-7-5-14(6-8-15)31-32-16-9-11-17(12-10-16)40(37,38)39/h1-12,30H,(H,37,38,39)/b32-31+,34-33+ |
| InChIKey | KAGUKXMQQFURAS-HSBKYFPUSA-N |
| XLogP | 6.75 |
| TPSA | 164.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.49 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|