C14H14N3NaO5S — CID 59012909
sodium 2,5-dimethoxy-4-[(4-oxidoperoxysulfanylphenyl)diazenyl]aniline (PubChem CID 59012909) has the molecular formula C14H14N3NaO5S and a molecular weight of 359.34 g/mol. Its IUPAC name is sodium 2,5-dimethoxy-4-[(4-oxidoperoxysulfanylphenyl)diazenyl]aniline.
| Compound Name | sodium 2,5-dimethoxy-4-[(4-oxidoperoxysulfanylphenyl)diazenyl]aniline |
|---|---|
| PubChem CID | 59012909 |
| Molecular Formula | C14H14N3NaO5S |
| Molecular Weight | 359.34 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | sodium 2,5-dimethoxy-4-[(4-oxidoperoxysulfanylphenyl)diazenyl]aniline |
| SMILES | COc1cc(/N=N/c2ccc(SOO[O-])cc2)c(OC)cc1N.[Na+] |
| InChI | InChI=1S/C14H15N3O5S.Na/c1-19-13-8-12(14(20-2)7-11(13)15)17-16-9-3-5-10(6-4-9)23-22-21-18;/h3-8,18H,15H2,1-2H3;/q;+1/p-1/b17-16+; |
| InChIKey | JZYWTGKHUGKNTI-CMBBICFISA-M |
| XLogP | -0.06 |
| TPSA | 110.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.34 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|