C18H24N4O6S — CID 88561091
4-[(4-amino-2,5-dimethoxyphenyl)diazenyl]-N,N-bis(2-hydroxyethyl)benzenesulfonamide (PubChem CID 88561091) has the molecular formula C18H24N4O6S and a molecular weight of 424.48 g/mol. Its IUPAC name is 4-[(4-amino-2,5-dimethoxyphenyl)diazenyl]-N,N-bis(2-hydroxyethyl)benzenesulfonamide.
| Compound Name | 4-[(4-amino-2,5-dimethoxyphenyl)diazenyl]-N,N-bis(2-hydroxyethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 88561091 |
| Molecular Formula | C18H24N4O6S |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | 4-[(4-amino-2,5-dimethoxyphenyl)diazenyl]-N,N-bis(2-hydroxyethyl)benzenesulfonamide |
| SMILES | COc1cc(/N=N/c2ccc(S(=O)(=O)N(CCO)CCO)cc2)c(OC)cc1N |
| InChI | InChI=1S/C18H24N4O6S/c1-27-17-12-16(18(28-2)11-15(17)19)21-20-13-3-5-14(6-4-13)29(25,26)22(7-9-23)8-10-24/h3-6,11-12,23-24H,7-10,19H2,1-2H3/b21-20+ |
| InChIKey | MLKRFAZWNKCVES-QZQOTICOSA-N |
| XLogP | 1.68 |
| TPSA | 147.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|