C27H30N2O5S — CID 53245822
4-[(E)-2-[4-[(E)-2-(4-aminophenyl)ethenyl]-3-methoxyphenyl]ethenyl]-N,N-bis(2-hydroxyethyl)benzenesulfonamide (PubChem CID 53245822) has the molecular formula C27H30N2O5S and a molecular weight of 494.61 g/mol. Its IUPAC name is 4-[(E)-2-[4-[(E)-2-(4-aminophenyl)ethenyl]-3-methoxyphenyl]ethenyl]-N,N-bis(2-hydroxyethyl)benzenesulfonamide.
| Compound Name | 4-[(E)-2-[4-[(E)-2-(4-aminophenyl)ethenyl]-3-methoxyphenyl]ethenyl]-N,N-bis(2-hydroxyethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 53245822 |
| Molecular Formula | C27H30N2O5S |
| Molecular Weight | 494.61 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | 4-[(E)-2-[4-[(E)-2-(4-aminophenyl)ethenyl]-3-methoxyphenyl]ethenyl]-N,N-bis(2-hydroxyethyl)benzenesulfonamide |
| SMILES | COc1cc(/C=C/c2ccc(S(=O)(=O)N(CCO)CCO)cc2)ccc1/C=C/c1ccc(N)cc1 |
| InChI | InChI=1S/C27H30N2O5S/c1-34-27-20-23(5-11-24(27)10-4-22-6-12-25(28)13-7-22)3-2-21-8-14-26(15-9-21)35(32,33)29(16-18-30)17-19-31/h2-15,20,30-31H,16-19,28H2,1H3/b3-2+,10-4+ |
| InChIKey | HIWNXJCTHNWBDL-KHVHPYDTSA-N |
| XLogP | 3.59 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.61 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|