C13H21NO6S — CID 61233827
N,N-bis(2-hydroxyethyl)-4-(2-methoxyethoxy)benzenesulfonamide (PubChem CID 61233827) has the molecular formula C13H21NO6S and a molecular weight of 319.38 g/mol. Its IUPAC name is N,N-bis(2-hydroxyethyl)-4-(2-methoxyethoxy)benzenesulfonamide.
| Compound Name | N,N-bis(2-hydroxyethyl)-4-(2-methoxyethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 61233827 |
| Molecular Formula | C13H21NO6S |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | N,N-bis(2-hydroxyethyl)-4-(2-methoxyethoxy)benzenesulfonamide |
| SMILES | COCCOc1ccc(S(=O)(=O)N(CCO)CCO)cc1 |
| InChI | InChI=1S/C13H21NO6S/c1-19-10-11-20-12-2-4-13(5-3-12)21(17,18)14(6-8-15)7-9-16/h2-5,15-16H,6-11H2,1H3 |
| InChIKey | LGZCLGNVMSAKGL-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|