C28H32N6O13S3 — CID 136968661
5-amino-3-[[4-[2-[4-[bis(2-hydroxyethyl)sulfamoyl]phenyl]hydrazinyl]-2,5-dimethoxyphenyl]diazenyl]-4-hydroxynaphthalene-2,7-disulfonic acid (PubChem CID 136968661) has the molecular formula C28H32N6O13S3 and a molecular weight of 756.79 g/mol. Its IUPAC name is 5-amino-3-[[4-[2-[4-[bis(2-hydroxyethyl)sulfamoyl]phenyl]hydrazinyl]-2,5-dimethoxyphenyl]diazenyl]-4-hydroxynaphthalene-2,7-disulfonic acid.
| Compound Name | 5-amino-3-[[4-[2-[4-[bis(2-hydroxyethyl)sulfamoyl]phenyl]hydrazinyl]-2,5-dimethoxyphenyl]diazenyl]-4-hydroxynaphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 136968661 |
| Molecular Formula | C28H32N6O13S3 |
| Molecular Weight | 756.79 g/mol |
| Exact Mass | 756.12 |
| IUPAC Name | 5-amino-3-[[4-[2-[4-[bis(2-hydroxyethyl)sulfamoyl]phenyl]hydrazinyl]-2,5-dimethoxyphenyl]diazenyl]-4-hydroxynaphthalene-2,7-disulfonic acid |
| SMILES | COc1cc(NNc2ccc(S(=O)(=O)N(CCO)CCO)cc2)c(OC)cc1/N=N/c1c(S(=O)(=O)O)cc2cc(S(=O)(=O)O)cc(N)c2c1O |
| InChI | InChI=1S/C28H32N6O13S3/c1-46-23-15-22(32-33-27-25(50(43,44)45)12-16-11-19(49(40,41)42)13-20(29)26(16)28(27)37)24(47-2)14-21(23)31-30-17-3-5-18(6-4-17)48(38,39)34(7-9-35)8-10-36/h3-6,11-15,30-31,35-37H,7-10,29H2,1-2H3,(H,40,41,42)(H,43,44,45)/b33-32+ |
| InChIKey | MUOKMPCJAMWKAT-ULIFNZDWSA-N |
| XLogP | 2.47 |
| TPSA | 300.07 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.79 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|