C28H34N6O12S3 — CID 118029533
5-amino-3-[2-[4-[2-[4-[bis(2-hydroxyethyl)sulfamoyl]phenyl]hydrazinyl]-2-methoxy-5-methylphenyl]hydrazinyl]-4-hydroxynaphthalene-2,7-disulfonic acid (PubChem CID 118029533) has the molecular formula C28H34N6O12S3 and a molecular weight of 742.81 g/mol. Its IUPAC name is 5-amino-3-[2-[4-[2-[4-[bis(2-hydroxyethyl)sulfamoyl]phenyl]hydrazinyl]-2-methoxy-5-methylphenyl]hydrazinyl]-4-hydroxynaphthalene-2,7-disulfonic acid.
| Compound Name | 5-amino-3-[2-[4-[2-[4-[bis(2-hydroxyethyl)sulfamoyl]phenyl]hydrazinyl]-2-methoxy-5-methylphenyl]hydrazinyl]-4-hydroxynaphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 118029533 |
| Molecular Formula | C28H34N6O12S3 |
| Molecular Weight | 742.81 g/mol |
| Exact Mass | 742.14 |
| IUPAC Name | 5-amino-3-[2-[4-[2-[4-[bis(2-hydroxyethyl)sulfamoyl]phenyl]hydrazinyl]-2-methoxy-5-methylphenyl]hydrazinyl]-4-hydroxynaphthalene-2,7-disulfonic acid |
| SMILES | COc1cc(NNc2ccc(S(=O)(=O)N(CCO)CCO)cc2)c(C)cc1NNc1c(S(=O)(=O)O)cc2cc(S(=O)(=O)O)cc(N)c2c1O |
| InChI | InChI=1S/C28H34N6O12S3/c1-16-11-23(32-33-27-25(49(43,44)45)13-17-12-20(48(40,41)42)14-21(29)26(17)28(27)37)24(46-2)15-22(16)31-30-18-3-5-19(6-4-18)47(38,39)34(7-9-35)8-10-36/h3-6,11-15,30-33,35-37H,7-10,29H2,1-2H3,(H,40,41,42)(H,43,44,45) |
| InChIKey | VXIVGENHCCEAAJ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 290.18 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.81 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|