C35H40N6O6S — CID 91326315
4-[2-[4-[2-(6-anilino-1-hydroxy-3-methylnaphthalen-2-yl)hydrazinyl]-5-methoxy-2-methylphenyl]hydrazinyl]-N,N-bis(2-hydroxyethyl)benzenesulfonamide (PubChem CID 91326315) has the molecular formula C35H40N6O6S and a molecular weight of 672.81 g/mol. Its IUPAC name is 4-[2-[4-[2-(6-anilino-1-hydroxy-3-methylnaphthalen-2-yl)hydrazinyl]-5-methoxy-2-methylphenyl]hydrazinyl]-N,N-bis(2-hydroxyethyl)benzenesulfonamide.
| Compound Name | 4-[2-[4-[2-(6-anilino-1-hydroxy-3-methylnaphthalen-2-yl)hydrazinyl]-5-methoxy-2-methylphenyl]hydrazinyl]-N,N-bis(2-hydroxyethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 91326315 |
| Molecular Formula | C35H40N6O6S |
| Molecular Weight | 672.81 g/mol |
| Exact Mass | 672.27 |
| IUPAC Name | 4-[2-[4-[2-(6-anilino-1-hydroxy-3-methylnaphthalen-2-yl)hydrazinyl]-5-methoxy-2-methylphenyl]hydrazinyl]-N,N-bis(2-hydroxyethyl)benzenesulfonamide |
| SMILES | COc1cc(NNc2ccc(S(=O)(=O)N(CCO)CCO)cc2)c(C)cc1NNc1c(C)cc2cc(Nc3ccccc3)ccc2c1O |
| InChI | InChI=1S/C35H40N6O6S/c1-23-20-32(39-40-34-24(2)19-25-21-28(11-14-30(25)35(34)44)36-26-7-5-4-6-8-26)33(47-3)22-31(23)38-37-27-9-12-29(13-10-27)48(45,46)41(15-17-42)16-18-43/h4-14,19-22,36-40,42-44H,15-18H2,1-3H3 |
| InChIKey | QJPUZMALWHOTPX-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 167.45 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.81 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|