C26H29NO — CID 58611361
2,6-ditert-butyl-4-[(naphthalen-2-ylmethylideneamino)methylidene]cyclohexa-2,5-dien-1-one (PubChem CID 58611361) has the molecular formula C26H29NO and a molecular weight of 371.52 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[(naphthalen-2-ylmethylideneamino)methylidene]cyclohexa-2,5-dien-1-one.
| Compound Name | 2,6-ditert-butyl-4-[(naphthalen-2-ylmethylideneamino)methylidene]cyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 58611361 |
| Molecular Formula | C26H29NO |
| Molecular Weight | 371.52 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | 2,6-ditert-butyl-4-[(naphthalen-2-ylmethylideneamino)methylidene]cyclohexa-2,5-dien-1-one |
| SMILES | CC(C)(C)C1=CC(=C/N=C/c2ccc3ccccc3c2)C=C(C(C)(C)C)C1=O |
| InChI | InChI=1S/C26H29NO/c1-25(2,3)22-14-19(15-23(24(22)28)26(4,5)6)17-27-16-18-11-12-20-9-7-8-10-21(20)13-18/h7-17H,1-6H3/b27-16+ |
| InChIKey | QLTQPYXYTUUEPD-JVWAILMASA-N |
| XLogP | 6.67 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.52 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|