C42H86N3O2+ — CID 58611470
bis[2-[[(Z)-heptadec-8-enoxy]methylamino]ethyl]-dimethylazanium (PubChem CID 58611470) has the molecular formula C42H86N3O2+ and a molecular weight of 665.17 g/mol. Its IUPAC name is bis[2-[[(Z)-heptadec-8-enoxy]methylamino]ethyl]-dimethylazanium.
| Compound Name | bis[2-[[(Z)-heptadec-8-enoxy]methylamino]ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 58611470 |
| Molecular Formula | C42H86N3O2+ |
| Molecular Weight | 665.17 g/mol |
| Exact Mass | 664.67 |
| IUPAC Name | bis[2-[[(Z)-heptadec-8-enoxy]methylamino]ethyl]-dimethylazanium |
| SMILES | CCCCCCCC/C=C\CCCCCCCOCNCC[N+](C)(C)CCNCOCCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C42H86N3O2/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-39-46-41-43-35-37-45(3,4)38-36-44-42-47-40-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h19-22,43-44H,5-18,23-42H2,1-4H3/q+1/b21-19-,22-20- |
| InChIKey | FKIHPFHYJWLVTG-WRBBJXAJSA-N |
| XLogP | 11.48 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.17 |
| LogP ≤ 5 | 11.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|