C44H87N4O2+ — CID 59046398
3-[2-aminoethyl-[2-[[(Z)-heptadec-8-enoxy]methylamino]ethyl]amino]propyl-[(Z)-octadec-9-enyl]-(oxomethylidene)azanium (PubChem CID 59046398) has the molecular formula C44H87N4O2+ and a molecular weight of 704.21 g/mol. Its IUPAC name is 3-[2-aminoethyl-[2-[[(Z)-heptadec-8-enoxy]methylamino]ethyl]amino]propyl-[(Z)-octadec-9-enyl]-(oxomethylidene)azanium.
| Compound Name | 3-[2-aminoethyl-[2-[[(Z)-heptadec-8-enoxy]methylamino]ethyl]amino]propyl-[(Z)-octadec-9-enyl]-(oxomethylidene)azanium |
|---|---|
| PubChem CID | 59046398 |
| Molecular Formula | C44H87N4O2+ |
| Molecular Weight | 704.21 g/mol |
| Exact Mass | 703.68 |
| IUPAC Name | 3-[2-aminoethyl-[2-[[(Z)-heptadec-8-enoxy]methylamino]ethyl]amino]propyl-[(Z)-octadec-9-enyl]-(oxomethylidene)azanium |
| SMILES | CCCCCCCC/C=C\CCCCCCCC[N+](=C=O)CCCN(CCN)CCNCOCCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C44H87N4O2/c1-3-5-7-9-11-13-15-17-19-20-22-24-26-28-30-32-37-48(44-49)39-34-38-47(40-35-45)41-36-46-43-50-42-33-31-29-27-25-23-21-18-16-14-12-10-8-6-4-2/h17-19,21,46H,3-16,20,22-43,45H2,1-2H3/q+1/b19-17-,21-18- |
| InChIKey | NQLIUCOGYHPZLS-HWSICPKZSA-N |
| XLogP | 11.23 |
| TPSA | 70.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.21 |
| LogP ≤ 5 | 11.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|