C27H26F3NO3 — CID 58615133
(4R,4aS,7aS,12bS)-3-(cyclopropylmethyl)-7-[3-(trifluoromethyl)phenyl]-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol (PubChem CID 58615133) has the molecular formula C27H26F3NO3 and a molecular weight of 469.50 g/mol. Its IUPAC name is (4R,4aS,7aS,12bS)-3-(cyclopropylmethyl)-7-[3-(trifluoromethyl)phenyl]-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol.
| Compound Name | (4R,4aS,7aS,12bS)-3-(cyclopropylmethyl)-7-[3-(trifluoromethyl)phenyl]-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol |
|---|---|
| PubChem CID | 58615133 |
| Molecular Formula | C27H26F3NO3 |
| Molecular Weight | 469.50 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | (4R,4aS,7aS,12bS)-3-(cyclopropylmethyl)-7-[3-(trifluoromethyl)phenyl]-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol |
| SMILES | Oc1ccc2c3c1O[C@H]1C(c4cccc(C(F)(F)F)c4)=CC[C@@]4(O)[C@@H](C2)N(CC2CC2)CC[C@]314 |
| InChI | InChI=1S/C27H26F3NO3/c28-27(29,30)18-3-1-2-16(12-18)19-8-9-26(33)21-13-17-6-7-20(32)23-22(17)25(26,24(19)34-23)10-11-31(21)14-15-4-5-15/h1-3,6-8,12,15,21,24,32-33H,4-5,9-11,13-14H2/t21-,24+,25+,26-/m1/s1 |
| InChIKey | YMIRXIQFRCAKCC-CBRSEMLDSA-N |
| XLogP | 4.67 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.50 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |