C27H29NO5S — CID 58615143
(4R,4aS,7aS,12bS)-3-(cyclopropylmethyl)-7-(4-methylsulfonylphenyl)-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol (PubChem CID 58615143) has the molecular formula C27H29NO5S and a molecular weight of 479.60 g/mol. Its IUPAC name is (4R,4aS,7aS,12bS)-3-(cyclopropylmethyl)-7-(4-methylsulfonylphenyl)-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol.
| Compound Name | (4R,4aS,7aS,12bS)-3-(cyclopropylmethyl)-7-(4-methylsulfonylphenyl)-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol |
|---|---|
| PubChem CID | 58615143 |
| Molecular Formula | C27H29NO5S |
| Molecular Weight | 479.60 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | (4R,4aS,7aS,12bS)-3-(cyclopropylmethyl)-7-(4-methylsulfonylphenyl)-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol |
| SMILES | CS(=O)(=O)c1ccc(C2=CC[C@@]3(O)[C@H]4Cc5ccc(O)c6c5[C@@]3(CCN4CC3CC3)[C@H]2O6)cc1 |
| InChI | InChI=1S/C27H29NO5S/c1-34(31,32)19-7-4-17(5-8-19)20-10-11-27(30)22-14-18-6-9-21(29)24-23(18)26(27,25(20)33-24)12-13-28(22)15-16-2-3-16/h4-10,16,22,25,29-30H,2-3,11-15H2,1H3/t22-,25+,26+,27-/m1/s1 |
| InChIKey | CUHNPZPERPYRDQ-LHIMOPHOSA-N |
| XLogP | 3.05 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.60 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |