C28H31NO3 — CID 58615138
(4R,4aS,7aS,12bS)-3-(cyclopropylmethyl)-7-(3,4-dimethylphenyl)-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol (PubChem CID 58615138) has the molecular formula C28H31NO3 and a molecular weight of 429.56 g/mol. Its IUPAC name is (4R,4aS,7aS,12bS)-3-(cyclopropylmethyl)-7-(3,4-dimethylphenyl)-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol.
| Compound Name | (4R,4aS,7aS,12bS)-3-(cyclopropylmethyl)-7-(3,4-dimethylphenyl)-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol |
|---|---|
| PubChem CID | 58615138 |
| Molecular Formula | C28H31NO3 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | (4R,4aS,7aS,12bS)-3-(cyclopropylmethyl)-7-(3,4-dimethylphenyl)-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-4a,9-diol |
| SMILES | Cc1ccc(C2=CC[C@@]3(O)[C@H]4Cc5ccc(O)c6c5[C@@]3(CCN4CC3CC3)[C@H]2O6)cc1C |
| InChI | InChI=1S/C28H31NO3/c1-16-3-6-19(13-17(16)2)21-9-10-28(31)23-14-20-7-8-22(30)25-24(20)27(28,26(21)32-25)11-12-29(23)15-18-4-5-18/h3,6-9,13,18,23,26,30-31H,4-5,10-12,14-15H2,1-2H3/t23-,26+,27+,28-/m1/s1 |
| InChIKey | ALADMBVNNCNEMI-HBMTYJCASA-N |
| XLogP | 4.27 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |