C31H33F3N4O4 — CID 58617690
2-[4-(5-acetamido-1H-indol-3-yl)piperidin-1-yl]-2-[1-[(E)-3-(3,4,5-trifluorophenyl)prop-2-enoyl]piperidin-4-yl]acetic acid (PubChem CID 58617690) has the molecular formula C31H33F3N4O4 and a molecular weight of 582.62 g/mol. Its IUPAC name is 2-[4-(5-acetamido-1H-indol-3-yl)piperidin-1-yl]-2-[1-[(E)-3-(3,4,5-trifluorophenyl)prop-2-enoyl]piperidin-4-yl]acetic acid.
| Compound Name | 2-[4-(5-acetamido-1H-indol-3-yl)piperidin-1-yl]-2-[1-[(E)-3-(3,4,5-trifluorophenyl)prop-2-enoyl]piperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 58617690 |
| Molecular Formula | C31H33F3N4O4 |
| Molecular Weight | 582.62 g/mol |
| Exact Mass | 582.25 |
| IUPAC Name | 2-[4-(5-acetamido-1H-indol-3-yl)piperidin-1-yl]-2-[1-[(E)-3-(3,4,5-trifluorophenyl)prop-2-enoyl]piperidin-4-yl]acetic acid |
| SMILES | CC(=O)Nc1ccc2[nH]cc(C3CCN(C(C(=O)O)C4CCN(C(=O)/C=C/c5cc(F)c(F)c(F)c5)CC4)CC3)c2c1 |
| InChI | InChI=1S/C31H33F3N4O4/c1-18(39)36-22-3-4-27-23(16-22)24(17-35-27)20-6-12-38(13-7-20)30(31(41)42)21-8-10-37(11-9-21)28(40)5-2-19-14-25(32)29(34)26(33)15-19/h2-5,14-17,20-21,30,35H,6-13H2,1H3,(H,36,39)(H,41,42)/b5-2+ |
| InChIKey | ALTZWEJDZWLGFT-GORDUTHDSA-N |
| XLogP | 5.13 |
| TPSA | 105.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.62 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|