C19H18N2O7 — CID 58620226
trans-methyl (1S,2S)-2-(hydroxycarbamoyl)-1-[3-[(3-nitrophenyl)methoxy]phenyl]cyclopropane-1-carboxylate (PubChem CID 58620226) has the molecular formula C19H18N2O7 and a molecular weight of 386.36 g/mol. Its IUPAC name is trans-methyl (1S,2S)-2-(hydroxycarbamoyl)-1-[3-[(3-nitrophenyl)methoxy]phenyl]cyclopropane-1-carboxylate.
| Compound Name | trans-methyl (1S,2S)-2-(hydroxycarbamoyl)-1-[3-[(3-nitrophenyl)methoxy]phenyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 58620226 |
| Molecular Formula | C19H18N2O7 |
| Molecular Weight | 386.36 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | trans-methyl (1S,2S)-2-(hydroxycarbamoyl)-1-[3-[(3-nitrophenyl)methoxy]phenyl]cyclopropane-1-carboxylate |
| SMILES | COC(=O)[C@@]1(c2cccc(OCc3cccc([N+](=O)[O-])c3)c2)C[C@@H]1C(=O)NO |
| InChI | InChI=1S/C19H18N2O7/c1-27-18(23)19(10-16(19)17(22)20-24)13-5-3-7-15(9-13)28-11-12-4-2-6-14(8-12)21(25)26/h2-9,16,24H,10-11H2,1H3,(H,20,22)/t16-,19-/m1/s1 |
| InChIKey | FGHQEBHTSZNGDM-VQIMIIECSA-N |
| XLogP | 2.11 |
| TPSA | 128.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.36 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|