C19H19N2O7- — CID 163707729
trans-methyl (1S,2S)-2-(hydroxycarbamoyl)-1-[3-[[3-[hydroxy(oxido)amino]phenyl]methoxy]phenyl]cyclopropane-1-carboxylate (PubChem CID 163707729) has the molecular formula C19H19N2O7- and a molecular weight of 387.37 g/mol. Its IUPAC name is trans-methyl (1S,2S)-2-(hydroxycarbamoyl)-1-[3-[[3-[hydroxy(oxido)amino]phenyl]methoxy]phenyl]cyclopropane-1-carboxylate.
| Compound Name | trans-methyl (1S,2S)-2-(hydroxycarbamoyl)-1-[3-[[3-[hydroxy(oxido)amino]phenyl]methoxy]phenyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 163707729 |
| Molecular Formula | C19H19N2O7- |
| Molecular Weight | 387.37 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | trans-methyl (1S,2S)-2-(hydroxycarbamoyl)-1-[3-[[3-[hydroxy(oxido)amino]phenyl]methoxy]phenyl]cyclopropane-1-carboxylate |
| SMILES | COC(=O)[C@@]1(c2cccc(OCc3cccc(N([O-])O)c3)c2)C[C@@H]1C(=O)NO |
| InChI | InChI=1S/C19H19N2O7/c1-27-18(23)19(10-16(19)17(22)20-24)13-5-3-7-15(9-13)28-11-12-4-2-6-14(8-12)21(25)26/h2-9,16,24-25H,10-11H2,1H3,(H,20,22)/q-1/t16-,19-/m1/s1 |
| InChIKey | FICCIMXUHOEPJS-VQIMIIECSA-N |
| XLogP | 1.90 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.37 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|