C28H20N3Pt- — CID 58620904
4-phenyl-2-(phenylmethyl)-6-(6-pyridin-2-yl-2-pyridinyl)pyridine;platinum (PubChem CID 58620904) has the molecular formula C28H20N3Pt- and a molecular weight of 593.57 g/mol. Its IUPAC name is 4-phenyl-2-(phenylmethyl)-6-(6-pyridin-2-yl-2-pyridinyl)pyridine;platinum.
| Compound Name | 4-phenyl-2-(phenylmethyl)-6-(6-pyridin-2-yl-2-pyridinyl)pyridine;platinum |
|---|---|
| PubChem CID | 58620904 |
| Molecular Formula | C28H20N3Pt- |
| Molecular Weight | 593.57 g/mol |
| Exact Mass | 593.13 |
| IUPAC Name | 4-phenyl-2-(phenylmethyl)-6-(6-pyridin-2-yl-2-pyridinyl)pyridine;platinum |
| SMILES | [Pt].[c-]1ccccc1Cc1cc(-c2ccccc2)cc(-c2cccc(-c3ccccn3)n2)n1 |
| InChI | InChI=1S/C28H20N3.Pt/c1-3-10-21(11-4-1)18-24-19-23(22-12-5-2-6-13-22)20-28(30-24)27-16-9-15-26(31-27)25-14-7-8-17-29-25;/h1-10,12-17,19-20H,18H2;/q-1; |
| InChIKey | RZNJEPCGDADSSM-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.57 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|