C23H26F5N3O6S — CID 58623170
N-hydroxy-1-(2-methoxyethyl)-4-[4-[5-(2,2,3,3,3-pentafluoropropoxy)-2-pyridinyl]phenyl]sulfonylpiperidine-4-carboxamide (PubChem CID 58623170) has the molecular formula C23H26F5N3O6S and a molecular weight of 567.53 g/mol. Its IUPAC name is N-hydroxy-1-(2-methoxyethyl)-4-[4-[5-(2,2,3,3,3-pentafluoropropoxy)-2-pyridinyl]phenyl]sulfonylpiperidine-4-carboxamide.
| Compound Name | N-hydroxy-1-(2-methoxyethyl)-4-[4-[5-(2,2,3,3,3-pentafluoropropoxy)-2-pyridinyl]phenyl]sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 58623170 |
| Molecular Formula | C23H26F5N3O6S |
| Molecular Weight | 567.53 g/mol |
| Exact Mass | 567.15 |
| IUPAC Name | N-hydroxy-1-(2-methoxyethyl)-4-[4-[5-(2,2,3,3,3-pentafluoropropoxy)-2-pyridinyl]phenyl]sulfonylpiperidine-4-carboxamide |
| SMILES | COCCN1CCC(C(=O)NO)(S(=O)(=O)c2ccc(-c3ccc(OCC(F)(F)C(F)(F)F)cn3)cc2)CC1 |
| InChI | InChI=1S/C23H26F5N3O6S/c1-36-13-12-31-10-8-21(9-11-31,20(32)30-33)38(34,35)18-5-2-16(3-6-18)19-7-4-17(14-29-19)37-15-22(24,25)23(26,27)28/h2-7,14,33H,8-13,15H2,1H3,(H,30,32) |
| InChIKey | NKLSNIDHFHYBCM-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 118.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.53 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|