C11H15NY13-2 — CID 58625893
N-ethyl-N,3,4-trimethylbenzene-6-id-1-amine;tridecakis(yttrium) (PubChem CID 58625893) has the molecular formula C11H15NY13-2 and a molecular weight of 1317.03 g/mol. Its IUPAC name is N-ethyl-N,3,4-trimethylbenzene-6-id-1-amine;tridecakis(yttrium).
| Compound Name | N-ethyl-N,3,4-trimethylbenzene-6-id-1-amine;tridecakis(yttrium) |
|---|---|
| PubChem CID | 58625893 |
| Molecular Formula | C11H15NY13-2 |
| Molecular Weight | 1317.03 g/mol |
| Exact Mass | 1316.90 |
| IUPAC Name | N-ethyl-N,3,4-trimethylbenzene-6-id-1-amine;tridecakis(yttrium) |
| SMILES | [CH2-]CN(C)c1[c-]cc(C)c(C)c1.[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y] |
| InChI | InChI=1S/C11H15N.13Y/c1-5-12(4)11-7-6-9(2)10(3)8-11;;;;;;;;;;;;;/h6,8H,1,5H2,2-4H3;;;;;;;;;;;;;/q-2;;;;;;;;;;;;; |
| InChIKey | BKPDFQZHVXVBKU-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 1317.03 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|