About 2-fluoro-8-(trifluoromethyl)-11H-benzo[b][1,4]benzodiazepin-6-amine
2-fluoro-8-(trifluoromethyl)-11H-benzo[b][1,4]benzodiazepin-6-amine (PubChem CID 58626019) has the molecular formula C14H9F4N3
and a molecular weight of 295.24 g/mol. Its IUPAC name is 2-fluoro-8-(trifluoromethyl)-11H-benzo[b][1,4]benzodiazepin-6-amine.
Molecular Properties
| Compound Name | 2-fluoro-8-(trifluoromethyl)-11H-benzo[b][1,4]benzodiazepin-6-amine |
| PubChem CID | 58626019 |
| Molecular Formula | C14H9F4N3 |
| Molecular Weight | 295.24 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 2-fluoro-8-(trifluoromethyl)-11H-benzo[b][1,4]benzodiazepin-6-amine |
| SMILES | NC1=Nc2ccc(F)cc2Nc2ccc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C14H9F4N3/c15-8-2-4-11-12(6-8)20-10-3-1-7(14(16,17)18)5-9(10)13(19)21-11/h1-6,20H,(H2,19,21) |
| InChIKey | VFIZDRLNVLGDGJ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.24 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-fluoro-8-(trifluoromethyl)-11H-benzo[b][1,4]benzodiazepin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-8-(trifluoromethyl)-11H-benzo[b][1,4]benzodiazepin-6-amine?
The IUPAC name of 2-fluoro-8-(trifluoromethyl)-11H-benzo[b][1,4]benzodiazepin-6-amine (CID 58626019) is 2-fluoro-8-(trifluoromethyl)-11H-benzo[b][1,4]benzodiazepin-6-amine.
What is the SMILES notation for 2-fluoro-8-(trifluoromethyl)-11H-benzo[b][1,4]benzodiazepin-6-amine?
The canonical SMILES for 2-fluoro-8-(trifluoromethyl)-11H-benzo[b][1,4]benzodiazepin-6-amine is NC1=Nc2ccc(F)cc2Nc2ccc(C(F)(F)F)cc21.
What is the InChIKey of 2-fluoro-8-(trifluoromethyl)-11H-benzo[b][1,4]benzodiazepin-6-amine?
The InChIKey is VFIZDRLNVLGDGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9F4N3/c15-8-2-4-11-12(6-8)20-10-3-1-7(14(16,17)18)5-9(10)13(19)21-11/h1-6,20H,(H2,19,21).
What are the key properties of 2-fluoro-8-(trifluoromethyl)-11H-benzo[b][1,4]benzodiazepin-6-amine?
2-fluoro-8-(trifluoromethyl)-11H-benzo[b][1,4]benzodiazepin-6-amine has a molecular weight of 295.24 g/mol, XLogP of 3.94, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-8-(trifluoromethyl)-11H-benzo[b][1,4]benzodiazepin-6-amine is sourced from PubChem (CID 58626019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).