C28H28N2O4 — CID 58626648
3-[2-methyl-4-[3-[5-methyl-2-(4-pyridin-2-ylphenyl)-1,3-oxazol-4-yl]propoxy]phenyl]propanoic acid (PubChem CID 58626648) has the molecular formula C28H28N2O4 and a molecular weight of 456.54 g/mol. Its IUPAC name is 3-[2-methyl-4-[3-[5-methyl-2-(4-pyridin-2-ylphenyl)-1,3-oxazol-4-yl]propoxy]phenyl]propanoic acid.
| Compound Name | 3-[2-methyl-4-[3-[5-methyl-2-(4-pyridin-2-ylphenyl)-1,3-oxazol-4-yl]propoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 58626648 |
| Molecular Formula | C28H28N2O4 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | 3-[2-methyl-4-[3-[5-methyl-2-(4-pyridin-2-ylphenyl)-1,3-oxazol-4-yl]propoxy]phenyl]propanoic acid |
| SMILES | Cc1cc(OCCCc2nc(-c3ccc(-c4ccccn4)cc3)oc2C)ccc1CCC(=O)O |
| InChI | InChI=1S/C28H28N2O4/c1-19-18-24(14-12-21(19)13-15-27(31)32)33-17-5-7-25-20(2)34-28(30-25)23-10-8-22(9-11-23)26-6-3-4-16-29-26/h3-4,6,8-12,14,16,18H,5,7,13,15,17H2,1-2H3,(H,31,32) |
| InChIKey | BCCDCWXHURPQRI-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 85.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|