C18H21FN4O2Si — CID 58626908
(5R)-3-[3-fluoro-4-(2-trimethylsilylethynyl)phenyl]-5-[(4-methyltriazol-1-yl)methyl]-1,3-oxazolidin-2-one (PubChem CID 58626908) has the molecular formula C18H21FN4O2Si and a molecular weight of 372.48 g/mol. Its IUPAC name is (5R)-3-[3-fluoro-4-(2-trimethylsilylethynyl)phenyl]-5-[(4-methyltriazol-1-yl)methyl]-1,3-oxazolidin-2-one.
| Compound Name | (5R)-3-[3-fluoro-4-(2-trimethylsilylethynyl)phenyl]-5-[(4-methyltriazol-1-yl)methyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 58626908 |
| Molecular Formula | C18H21FN4O2Si |
| Molecular Weight | 372.48 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | (5R)-3-[3-fluoro-4-(2-trimethylsilylethynyl)phenyl]-5-[(4-methyltriazol-1-yl)methyl]-1,3-oxazolidin-2-one |
| SMILES | Cc1cn(C[C@H]2CN(c3ccc(C#C[Si](C)(C)C)c(F)c3)C(=O)O2)nn1 |
| InChI | InChI=1S/C18H21FN4O2Si/c1-13-10-22(21-20-13)11-16-12-23(18(24)25-16)15-6-5-14(17(19)9-15)7-8-26(2,3)4/h5-6,9-10,16H,11-12H2,1-4H3/t16-/m0/s1 |
| InChIKey | NJJZOHMTMKKXEQ-INIZCTEOSA-N |
| XLogP | 2.98 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.48 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|