C25H27FN8O6 — CID 134816452
N-[2-[4-[2-fluoro-4-[(5R)-5-[(4-methyltriazol-1-yl)methyl]-2-oxo-1,3-oxazolidin-3-yl]phenyl]piperazin-1-yl]-2-oxoethyl]-4-nitrocyclopenta-1,3-diene-1-carboxamide (PubChem CID 134816452) has the molecular formula C25H27FN8O6 and a molecular weight of 554.54 g/mol. Its IUPAC name is N-[2-[4-[2-fluoro-4-[(5R)-5-[(4-methyltriazol-1-yl)methyl]-2-oxo-1,3-oxazolidin-3-yl]phenyl]piperazin-1-yl]-2-oxoethyl]-4-nitrocyclopenta-1,3-diene-1-carboxamide.
| Compound Name | N-[2-[4-[2-fluoro-4-[(5R)-5-[(4-methyltriazol-1-yl)methyl]-2-oxo-1,3-oxazolidin-3-yl]phenyl]piperazin-1-yl]-2-oxoethyl]-4-nitrocyclopenta-1,3-diene-1-carboxamide |
|---|---|
| PubChem CID | 134816452 |
| Molecular Formula | C25H27FN8O6 |
| Molecular Weight | 554.54 g/mol |
| Exact Mass | 554.20 |
| IUPAC Name | N-[2-[4-[2-fluoro-4-[(5R)-5-[(4-methyltriazol-1-yl)methyl]-2-oxo-1,3-oxazolidin-3-yl]phenyl]piperazin-1-yl]-2-oxoethyl]-4-nitrocyclopenta-1,3-diene-1-carboxamide |
| SMILES | Cc1cn(C[C@H]2CN(c3ccc(N4CCN(C(=O)CNC(=O)C5=CC=C([N+](=O)[O-])C5)CC4)c(F)c3)C(=O)O2)nn1 |
| InChI | InChI=1S/C25H27FN8O6/c1-16-13-32(29-28-16)14-20-15-33(25(37)40-20)18-4-5-22(21(26)11-18)30-6-8-31(9-7-30)23(35)12-27-24(36)17-2-3-19(10-17)34(38)39/h2-5,11,13,20H,6-10,12,14-15H2,1H3,(H,27,36)/t20-/m0/s1 |
| InChIKey | FXTLVYCRHAXRCJ-FQEVSTJZSA-N |
| XLogP | 1.01 |
| TPSA | 156.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.54 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|