C19H32O7 — CID 58626919
(2R,3S)-1-(6-ethyl-4,6-dihydroxyoxan-3-yl)-3-hydroxy-2-(hydroxymethyl)-3-[(2S,3R)-2-methyl-3-[(2S)-pent-4-en-2-yl]oxiran-2-yl]propan-1-one (PubChem CID 58626919) has the molecular formula C19H32O7 and a molecular weight of 372.46 g/mol. Its IUPAC name is (2R,3S)-1-(6-ethyl-4,6-dihydroxyoxan-3-yl)-3-hydroxy-2-(hydroxymethyl)-3-[(2S,3R)-2-methyl-3-[(2S)-pent-4-en-2-yl]oxiran-2-yl]propan-1-one.
| Compound Name | (2R,3S)-1-(6-ethyl-4,6-dihydroxyoxan-3-yl)-3-hydroxy-2-(hydroxymethyl)-3-[(2S,3R)-2-methyl-3-[(2S)-pent-4-en-2-yl]oxiran-2-yl]propan-1-one |
|---|---|
| PubChem CID | 58626919 |
| Molecular Formula | C19H32O7 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | (2R,3S)-1-(6-ethyl-4,6-dihydroxyoxan-3-yl)-3-hydroxy-2-(hydroxymethyl)-3-[(2S,3R)-2-methyl-3-[(2S)-pent-4-en-2-yl]oxiran-2-yl]propan-1-one |
| SMILES | C=CC[C@H](C)[C@H]1O[C@@]1(C)[C@@H](O)[C@@H](CO)C(=O)C1COC(O)(CC)CC1O |
| InChI | InChI=1S/C19H32O7/c1-5-7-11(3)17-18(4,26-17)16(23)12(9-20)15(22)13-10-25-19(24,6-2)8-14(13)21/h5,11-14,16-17,20-21,23-24H,1,6-10H2,2-4H3/t11-,12-,13?,14?,16-,17+,18-,19?/m0/s1 |
| InChIKey | DNEGWVOFTUFQDT-KAWHXHIASA-N |
| XLogP | 0.39 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|