C18H23NO2 — CID 58626985
ethyl (2R)-2-[(1S,3R)-1-benzyl-3-methylcyclopentyl]-2-cyanoacetate (PubChem CID 58626985) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is ethyl (2R)-2-[(1S,3R)-1-benzyl-3-methylcyclopentyl]-2-cyanoacetate.
| Compound Name | ethyl (2R)-2-[(1S,3R)-1-benzyl-3-methylcyclopentyl]-2-cyanoacetate |
|---|---|
| PubChem CID | 58626985 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | ethyl (2R)-2-[(1S,3R)-1-benzyl-3-methylcyclopentyl]-2-cyanoacetate |
| SMILES | CCOC(=O)[C@@H](C#N)[C@@]1(Cc2ccccc2)CC[C@@H](C)C1 |
| InChI | InChI=1S/C18H23NO2/c1-3-21-17(20)16(13-19)18(10-9-14(2)11-18)12-15-7-5-4-6-8-15/h4-8,14,16H,3,9-12H2,1-2H3/t14-,16-,18+/m1/s1 |
| InChIKey | BAVCVJKQMMZMPZ-KYJSFNMBSA-N |
| XLogP | 3.74 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |