C16H13N3O5 — CID 10042089
2-[1-cyano-1-(1-cyano-2-ethoxy-2-oxoethyl)-3-oxoisoindol-2-yl]acetic acid (PubChem CID 10042089) has the molecular formula C16H13N3O5 and a molecular weight of 327.30 g/mol. Its IUPAC name is 2-[1-cyano-1-(1-cyano-2-ethoxy-2-oxoethyl)-3-oxoisoindol-2-yl]acetic acid.
| Compound Name | 2-[1-cyano-1-(1-cyano-2-ethoxy-2-oxoethyl)-3-oxoisoindol-2-yl]acetic acid |
|---|---|
| PubChem CID | 10042089 |
| Molecular Formula | C16H13N3O5 |
| Molecular Weight | 327.30 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 2-[1-cyano-1-(1-cyano-2-ethoxy-2-oxoethyl)-3-oxoisoindol-2-yl]acetic acid |
| SMILES | CCOC(=O)C(C#N)C1(C#N)c2ccccc2C(=O)N1CC(=O)O |
| InChI | InChI=1S/C16H13N3O5/c1-2-24-15(23)12(7-17)16(9-18)11-6-4-3-5-10(11)14(22)19(16)8-13(20)21/h3-6,12H,2,8H2,1H3,(H,20,21) |
| InChIKey | LLHNRRCYMOPWMT-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 131.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.30 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |