C14H12ClN3O5 — CID 135003689
ethyl (2R)-2-[(3S)-7-chloro-3-(nitromethyl)-2-oxo-1H-indol-3-yl]-2-cyanoacetate (PubChem CID 135003689) has the molecular formula C14H12ClN3O5 and a molecular weight of 337.72 g/mol. Its IUPAC name is ethyl (2R)-2-[(3S)-7-chloro-3-(nitromethyl)-2-oxo-1H-indol-3-yl]-2-cyanoacetate.
| Compound Name | ethyl (2R)-2-[(3S)-7-chloro-3-(nitromethyl)-2-oxo-1H-indol-3-yl]-2-cyanoacetate |
|---|---|
| PubChem CID | 135003689 |
| Molecular Formula | C14H12ClN3O5 |
| Molecular Weight | 337.72 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | ethyl (2R)-2-[(3S)-7-chloro-3-(nitromethyl)-2-oxo-1H-indol-3-yl]-2-cyanoacetate |
| SMILES | CCOC(=O)[C@@H](C#N)[C@]1(C[N+](=O)[O-])C(=O)Nc2c(Cl)cccc21 |
| InChI | InChI=1S/C14H12ClN3O5/c1-2-23-12(19)9(6-16)14(7-18(21)22)8-4-3-5-10(15)11(8)17-13(14)20/h3-5,9H,2,7H2,1H3,(H,17,20)/t9-,14-/m1/s1 |
| InChIKey | KCMXWVXGBKDDMS-YMTOWFKASA-N |
| XLogP | 1.51 |
| TPSA | 122.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.72 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|