C15H18ClN3O5 — CID 134950500
tert-butyl N-[(3S)-7-chloro-3-(1-nitroethyl)-2-oxo-1H-indol-3-yl]carbamate (PubChem CID 134950500) has the molecular formula C15H18ClN3O5 and a molecular weight of 355.78 g/mol. Its IUPAC name is tert-butyl N-[(3S)-7-chloro-3-(1-nitroethyl)-2-oxo-1H-indol-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-7-chloro-3-(1-nitroethyl)-2-oxo-1H-indol-3-yl]carbamate |
|---|---|
| PubChem CID | 134950500 |
| Molecular Formula | C15H18ClN3O5 |
| Molecular Weight | 355.78 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | tert-butyl N-[(3S)-7-chloro-3-(1-nitroethyl)-2-oxo-1H-indol-3-yl]carbamate |
| SMILES | CC([N+](=O)[O-])[C@]1(NC(=O)OC(C)(C)C)C(=O)Nc2c(Cl)cccc21 |
| InChI | InChI=1S/C15H18ClN3O5/c1-8(19(22)23)15(18-13(21)24-14(2,3)4)9-6-5-7-10(16)11(9)17-12(15)20/h5-8H,1-4H3,(H,17,20)(H,18,21)/t8?,15-/m1/s1 |
| InChIKey | MVKHDUHUCQHSEN-LXCSWDKBSA-N |
| XLogP | 2.68 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.78 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|