C15H10ClNO4 — CID 915183
ethyl (2S)-2-(3-chloro-1,4-dioxonaphthalen-2-yl)-2-cyanoacetate (PubChem CID 915183) has the molecular formula C15H10ClNO4 and a molecular weight of 303.70 g/mol. Its IUPAC name is ethyl (2S)-2-(3-chloro-1,4-dioxonaphthalen-2-yl)-2-cyanoacetate.
| Compound Name | ethyl (2S)-2-(3-chloro-1,4-dioxonaphthalen-2-yl)-2-cyanoacetate |
|---|---|
| PubChem CID | 915183 |
| Molecular Formula | C15H10ClNO4 |
| Molecular Weight | 303.70 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | ethyl (2S)-2-(3-chloro-1,4-dioxonaphthalen-2-yl)-2-cyanoacetate |
| SMILES | CCOC(=O)[C@H](C#N)C1=C(Cl)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C15H10ClNO4/c1-2-21-15(20)10(7-17)11-12(16)14(19)9-6-4-3-5-8(9)13(11)18/h3-6,10H,2H2,1H3/t10-/m1/s1 |
| InChIKey | MQFPUDFVKBOKAR-SNVBAGLBSA-N |
| XLogP | 2.26 |
| TPSA | 84.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.70 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|