C15H11NO4 — CID 617085
methyl 2-cyano-2-(3-methyl-1,4-dioxonaphthalen-2-yl)acetate (PubChem CID 617085) has the molecular formula C15H11NO4 and a molecular weight of 269.26 g/mol. Its IUPAC name is methyl 2-cyano-2-(3-methyl-1,4-dioxonaphthalen-2-yl)acetate.
| Compound Name | methyl 2-cyano-2-(3-methyl-1,4-dioxonaphthalen-2-yl)acetate |
|---|---|
| PubChem CID | 617085 |
| Molecular Formula | C15H11NO4 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | methyl 2-cyano-2-(3-methyl-1,4-dioxonaphthalen-2-yl)acetate |
| SMILES | COC(=O)C(C#N)C1=C(C)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C15H11NO4/c1-8-12(11(7-16)15(19)20-2)14(18)10-6-4-3-5-9(10)13(8)17/h3-6,11H,1-2H3 |
| InChIKey | ZSOZRKMUQVMPED-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 84.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|