C16H13NO4 — CID 611226
4-cyano-4-(3-methyl-1,4-dioxonaphthalen-2-yl)butanoic acid (PubChem CID 611226) has the molecular formula C16H13NO4 and a molecular weight of 283.28 g/mol. Its IUPAC name is 4-cyano-4-(3-methyl-1,4-dioxonaphthalen-2-yl)butanoic acid.
| Compound Name | 4-cyano-4-(3-methyl-1,4-dioxonaphthalen-2-yl)butanoic acid |
|---|---|
| PubChem CID | 611226 |
| Molecular Formula | C16H13NO4 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 4-cyano-4-(3-methyl-1,4-dioxonaphthalen-2-yl)butanoic acid |
| SMILES | CC1=C(C(C#N)CCC(=O)O)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C16H13NO4/c1-9-14(10(8-17)6-7-13(18)19)16(21)12-5-3-2-4-11(12)15(9)20/h2-5,10H,6-7H2,1H3,(H,18,19) |
| InChIKey | KQNCRXNTDRRNSR-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 95.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|