C19H16FNO7 — CID 58627514
(4aS,5aR,12aR)-7-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 58627514) has the molecular formula C19H16FNO7 and a molecular weight of 389.34 g/mol. Its IUPAC name is (4aS,5aR,12aR)-7-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aR)-7-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 58627514 |
| Molecular Formula | C19H16FNO7 |
| Molecular Weight | 389.34 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | (4aS,5aR,12aR)-7-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | NC(=O)C1=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)ccc(F)c4C[C@H]3C[C@H]2CC1=O |
| InChI | InChI=1S/C19H16FNO7/c20-9-1-2-10(22)13-8(9)4-6-3-7-5-11(23)14(18(21)27)17(26)19(7,28)16(25)12(6)15(13)24/h1-2,6-7,22,24,26,28H,3-5H2,(H2,21,27)/t6-,7+,19+/m1/s1 |
| InChIKey | GXYFTQQOIPTREH-LKWPHKCZSA-N |
| XLogP | 0.56 |
| TPSA | 158.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.34 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|