C23H19ClN2O7 — CID 58627523
(4aS,5aR,12aR)-7-(5-chloro-1H-pyrrol-2-yl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 58627523) has the molecular formula C23H19ClN2O7 and a molecular weight of 470.87 g/mol. Its IUPAC name is (4aS,5aR,12aR)-7-(5-chloro-1H-pyrrol-2-yl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aR)-7-(5-chloro-1H-pyrrol-2-yl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 58627523 |
| Molecular Formula | C23H19ClN2O7 |
| Molecular Weight | 470.87 g/mol |
| Exact Mass | 470.09 |
| IUPAC Name | (4aS,5aR,12aR)-7-(5-chloro-1H-pyrrol-2-yl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | NC(=O)C1=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)ccc(-c5ccc(Cl)[nH]5)c4C[C@H]3C[C@H]2CC1=O |
| InChI | InChI=1S/C23H19ClN2O7/c24-15-4-2-12(26-15)10-1-3-13(27)17-11(10)6-8-5-9-7-14(28)18(22(25)32)21(31)23(9,33)20(30)16(8)19(17)29/h1-4,8-9,26-27,29,31,33H,5-7H2,(H2,25,32)/t8-,9+,23+/m1/s1 |
| InChIKey | WLQKWPWIKYQFEE-OIFKANJSSA-N |
| XLogP | 2.07 |
| TPSA | 173.94 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.87 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|