C28H31N3O7 — CID 58461332
(4R,4aR,5aS,12aS)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-[3-(1H-pyrrol-2-yl)propyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 58461332) has the molecular formula C28H31N3O7 and a molecular weight of 521.57 g/mol. Its IUPAC name is (4R,4aR,5aS,12aS)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-[3-(1H-pyrrol-2-yl)propyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4R,4aR,5aS,12aS)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-[3-(1H-pyrrol-2-yl)propyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 58461332 |
| Molecular Formula | C28H31N3O7 |
| Molecular Weight | 521.57 g/mol |
| Exact Mass | 521.22 |
| IUPAC Name | (4R,4aR,5aS,12aS)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-[3-(1H-pyrrol-2-yl)propyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)[C@H]1C(=O)C(C(N)=O)=C(O)[C@]2(O)C(=O)C3=C(O)c4c(O)ccc(CCCc5ccc[nH]5)c4C[C@@H]3C[C@H]12 |
| InChI | InChI=1S/C28H31N3O7/c1-31(2)22-17-12-14-11-16-13(5-3-6-15-7-4-10-30-15)8-9-18(32)20(16)23(33)19(14)25(35)28(17,38)26(36)21(24(22)34)27(29)37/h4,7-10,14,17,22,30,32-33,36,38H,3,5-6,11-12H2,1-2H3,(H2,29,37)/t14-,17-,22-,28-/m1/s1 |
| InChIKey | UVICWTAFPSMXJM-CHAVJQNCSA-N |
| XLogP | 1.47 |
| TPSA | 177.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.57 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|