C23H23N7O — CID 58628472
3-(3-aminophenyl)-N-(4-piperazin-1-ylphenyl)pyrazolo[1,5-a]pyrimidine-5-carboxamide (PubChem CID 58628472) has the molecular formula C23H23N7O and a molecular weight of 413.49 g/mol. Its IUPAC name is 3-(3-aminophenyl)-N-(4-piperazin-1-ylphenyl)pyrazolo[1,5-a]pyrimidine-5-carboxamide.
| Compound Name | 3-(3-aminophenyl)-N-(4-piperazin-1-ylphenyl)pyrazolo[1,5-a]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 58628472 |
| Molecular Formula | C23H23N7O |
| Molecular Weight | 413.49 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | 3-(3-aminophenyl)-N-(4-piperazin-1-ylphenyl)pyrazolo[1,5-a]pyrimidine-5-carboxamide |
| SMILES | Nc1cccc(-c2cnn3ccc(C(=O)Nc4ccc(N5CCNCC5)cc4)nc23)c1 |
| InChI | InChI=1S/C23H23N7O/c24-17-3-1-2-16(14-17)20-15-26-30-11-8-21(28-22(20)30)23(31)27-18-4-6-19(7-5-18)29-12-9-25-10-13-29/h1-8,11,14-15,25H,9-10,12-13,24H2,(H,27,31) |
| InChIKey | HSTARAPIMKSMKI-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 100.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.49 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|