C30H29N7O — CID 58628881
3-[4-(benzylamino)phenyl]-N-(4-piperazin-1-ylphenyl)pyrazolo[1,5-a]pyrimidine-5-carboxamide (PubChem CID 58628881) has the molecular formula C30H29N7O and a molecular weight of 503.61 g/mol. Its IUPAC name is 3-[4-(benzylamino)phenyl]-N-(4-piperazin-1-ylphenyl)pyrazolo[1,5-a]pyrimidine-5-carboxamide.
| Compound Name | 3-[4-(benzylamino)phenyl]-N-(4-piperazin-1-ylphenyl)pyrazolo[1,5-a]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 58628881 |
| Molecular Formula | C30H29N7O |
| Molecular Weight | 503.61 g/mol |
| Exact Mass | 503.24 |
| IUPAC Name | 3-[4-(benzylamino)phenyl]-N-(4-piperazin-1-ylphenyl)pyrazolo[1,5-a]pyrimidine-5-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCNCC2)cc1)c1ccn2ncc(-c3ccc(NCc4ccccc4)cc3)c2n1 |
| InChI | InChI=1S/C30H29N7O/c38-30(34-25-10-12-26(13-11-25)36-18-15-31-16-19-36)28-14-17-37-29(35-28)27(21-33-37)23-6-8-24(9-7-23)32-20-22-4-2-1-3-5-22/h1-14,17,21,31-32H,15-16,18-20H2,(H,34,38) |
| InChIKey | OYVPMLRDRVQUMO-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 86.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.61 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|