C15H10ClN2O2S2Y- — CID 58631992
7-chloro-4-methyl-2-(2-methyl-4-nitrobenzene-6-id-1-yl)sulfanyl-1,3-benzothiazole;yttrium (PubChem CID 58631992) has the molecular formula C15H10ClN2O2S2Y- and a molecular weight of 438.75 g/mol. Its IUPAC name is 7-chloro-4-methyl-2-(2-methyl-4-nitrobenzene-6-id-1-yl)sulfanyl-1,3-benzothiazole;yttrium.
| Compound Name | 7-chloro-4-methyl-2-(2-methyl-4-nitrobenzene-6-id-1-yl)sulfanyl-1,3-benzothiazole;yttrium |
|---|---|
| PubChem CID | 58631992 |
| Molecular Formula | C15H10ClN2O2S2Y- |
| Molecular Weight | 438.75 g/mol |
| Exact Mass | 437.89 |
| IUPAC Name | 7-chloro-4-methyl-2-(2-methyl-4-nitrobenzene-6-id-1-yl)sulfanyl-1,3-benzothiazole;yttrium |
| SMILES | Cc1cc([N+](=O)[O-])c[c-]c1Sc1nc2c(C)ccc(Cl)c2s1.[Y] |
| InChI | InChI=1S/C15H10ClN2O2S2.Y/c1-8-3-5-11(16)14-13(8)17-15(22-14)21-12-6-4-10(18(19)20)7-9(12)2;/h3-5,7H,1-2H3;/q-1; |
| InChIKey | IQZGRXGPSHQHBU-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.75 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|