C15H12N2O2 — CID 58636852
3-[(5-formyl-2,4-dimethyl-3-pyridinyl)oxy]benzonitrile (PubChem CID 58636852) has the molecular formula C15H12N2O2 and a molecular weight of 252.27 g/mol. Its IUPAC name is 3-[(5-formyl-2,4-dimethyl-3-pyridinyl)oxy]benzonitrile.
| Compound Name | 3-[(5-formyl-2,4-dimethyl-3-pyridinyl)oxy]benzonitrile |
|---|---|
| PubChem CID | 58636852 |
| Molecular Formula | C15H12N2O2 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 3-[(5-formyl-2,4-dimethyl-3-pyridinyl)oxy]benzonitrile |
| SMILES | Cc1ncc(C=O)c(C)c1Oc1cccc(C#N)c1 |
| InChI | InChI=1S/C15H12N2O2/c1-10-13(9-18)8-17-11(2)15(10)19-14-5-3-4-12(6-14)7-16/h3-6,8-9H,1-2H3 |
| InChIKey | BVKSEIVLEBPPNJ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|