About bromoplatinum(1+);2-(2-phenoxy-5-pyridin-2-ylbenzene-6-id-1-yl)pyridine
bromoplatinum(1+);2-(2-phenoxy-5-pyridin-2-ylbenzene-6-id-1-yl)pyridine (PubChem CID 58637269) has the molecular formula C22H15BrN2OPt
and a molecular weight of 598.36 g/mol. Its IUPAC name is bromoplatinum(1+);2-(2-phenoxy-5-pyridin-2-ylbenzene-6-id-1-yl)pyridine.
Molecular Properties
| Compound Name | bromoplatinum(1+);2-(2-phenoxy-5-pyridin-2-ylbenzene-6-id-1-yl)pyridine |
| PubChem CID | 58637269 |
| Molecular Formula | C22H15BrN2OPt |
| Molecular Weight | 598.36 g/mol |
| Exact Mass | 597.00 |
| IUPAC Name | bromoplatinum(1+);2-(2-phenoxy-5-pyridin-2-ylbenzene-6-id-1-yl)pyridine |
| SMILES | Br[Pt+].[c-]1c(-c2ccccn2)ccc(Oc2ccccc2)c1-c1ccccn1 |
| InChI | InChI=1S/C22H15N2O.BrH.Pt/c1-2-8-18(9-3-1)25-22-13-12-17(20-10-4-6-14-23-20)16-19(22)21-11-5-7-15-24-21;;/h1-15H;1H;/q-1;;+2/p-1 |
| InChIKey | DJGJDWNNRQDNNM-UHFFFAOYSA-M |
| XLogP | 6.25 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 598.36 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze bromoplatinum(1+);2-(2-phenoxy-5-pyridin-2-ylbenzene-6-id-1-yl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromoplatinum(1+);2-(2-phenoxy-5-pyridin-2-ylbenzene-6-id-1-yl)pyridine?
The IUPAC name of bromoplatinum(1+);2-(2-phenoxy-5-pyridin-2-ylbenzene-6-id-1-yl)pyridine (CID 58637269) is bromoplatinum(1+);2-(2-phenoxy-5-pyridin-2-ylbenzene-6-id-1-yl)pyridine.
What is the SMILES notation for bromoplatinum(1+);2-(2-phenoxy-5-pyridin-2-ylbenzene-6-id-1-yl)pyridine?
The canonical SMILES for bromoplatinum(1+);2-(2-phenoxy-5-pyridin-2-ylbenzene-6-id-1-yl)pyridine is Br[Pt+].[c-]1c(-c2ccccn2)ccc(Oc2ccccc2)c1-c1ccccn1.
What is the InChIKey of bromoplatinum(1+);2-(2-phenoxy-5-pyridin-2-ylbenzene-6-id-1-yl)pyridine?
The InChIKey is DJGJDWNNRQDNNM-UHFFFAOYSA-M. The full InChI is InChI=1S/C22H15N2O.BrH.Pt/c1-2-8-18(9-3-1)25-22-13-12-17(20-10-4-6-14-23-20)16-19(22)21-11-5-7-15-24-21;;/h1-15H;1H;/q-1;;+2/p-1.
What are the key properties of bromoplatinum(1+);2-(2-phenoxy-5-pyridin-2-ylbenzene-6-id-1-yl)pyridine?
bromoplatinum(1+);2-(2-phenoxy-5-pyridin-2-ylbenzene-6-id-1-yl)pyridine has a molecular weight of 598.36 g/mol, XLogP of 6.25, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bromoplatinum(1+);2-(2-phenoxy-5-pyridin-2-ylbenzene-6-id-1-yl)pyridine is sourced from PubChem (CID 58637269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).