C11H18N2O5 — CID 58637745
dimethyl 2-(2-aminopent-4-enoylamino)butanedioate (PubChem CID 58637745) has the molecular formula C11H18N2O5 and a molecular weight of 258.27 g/mol. Its IUPAC name is dimethyl 2-(2-aminopent-4-enoylamino)butanedioate.
| Compound Name | dimethyl 2-(2-aminopent-4-enoylamino)butanedioate |
|---|---|
| PubChem CID | 58637745 |
| Molecular Formula | C11H18N2O5 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | dimethyl 2-(2-aminopent-4-enoylamino)butanedioate |
| SMILES | C=CCC(N)C(=O)NC(CC(=O)OC)C(=O)OC |
| InChI | InChI=1S/C11H18N2O5/c1-4-5-7(12)10(15)13-8(11(16)18-3)6-9(14)17-2/h4,7-8H,1,5-6,12H2,2-3H3,(H,13,15) |
| InChIKey | WCCFBDUKNCDYHF-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|