C8H11F3N2O3 — CID 139540597
methyl 3-amino-2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoate (PubChem CID 139540597) has the molecular formula C8H11F3N2O3 and a molecular weight of 240.18 g/mol. Its IUPAC name is methyl 3-amino-2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoate.
| Compound Name | methyl 3-amino-2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoate |
|---|---|
| PubChem CID | 139540597 |
| Molecular Formula | C8H11F3N2O3 |
| Molecular Weight | 240.18 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | methyl 3-amino-2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoate |
| SMILES | C=CC(N)C(NC(=O)C(F)(F)F)C(=O)OC |
| InChI | InChI=1S/C8H11F3N2O3/c1-3-4(12)5(6(14)16-2)13-7(15)8(9,10)11/h3-5H,1,12H2,2H3,(H,13,15) |
| InChIKey | XLNLEBKQAVAFGM-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.18 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|