methyl (2S)-2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoate

C8H10F3NO3 — CID 135006947

IUPACmethyl (2S)-2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoate
SMILESC=CC[C@H](NC(=O)C(F)(F)F)C(=O)OC
InChIInChI=1S/C8H10F3NO3/c1-3-4-5(6(13)15-2)12-7(14)8(9,10)11/h3,5H,1,4H2,2H3,(H,12,14)/t5-/m0/s1
InChIKeyVNPXNDOZIPVROE-YFKPBYRVSA-N
MW225.17 g/mol
LogP0.78
Rot. Bonds4

About methyl (2S)-2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoate

methyl (2S)-2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoate (PubChem CID 135006947) has the molecular formula C8H10F3NO3 and a molecular weight of 225.17 g/mol. Its IUPAC name is methyl (2S)-2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoate.

Molecular Properties

Compound Namemethyl (2S)-2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoate
PubChem CID135006947
Molecular FormulaC8H10F3NO3
Molecular Weight225.17 g/mol
Exact Mass225.06
IUPAC Namemethyl (2S)-2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoate
SMILESC=CC[C@H](NC(=O)C(F)(F)F)C(=O)OC
InChIInChI=1S/C8H10F3NO3/c1-3-4-5(6(13)15-2)12-7(14)8(9,10)11/h3,5H,1,4H2,2H3,(H,12,14)/t5-/m0/s1
InChIKeyVNPXNDOZIPVROE-YFKPBYRVSA-N
XLogP0.78
TPSA55.40 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500225.17
LogP ≤ 50.78
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze methyl (2S)-2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (2S)-2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoate?
The IUPAC name of methyl (2S)-2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoate (CID 135006947) is methyl (2S)-2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoate.
What is the SMILES notation for methyl (2S)-2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoate?
The canonical SMILES for methyl (2S)-2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoate is C=CC[C@H](NC(=O)C(F)(F)F)C(=O)OC.
What is the InChIKey of methyl (2S)-2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoate?
The InChIKey is VNPXNDOZIPVROE-YFKPBYRVSA-N. The full InChI is InChI=1S/C8H10F3NO3/c1-3-4-5(6(13)15-2)12-7(14)8(9,10)11/h3,5H,1,4H2,2H3,(H,12,14)/t5-/m0/s1.
What are the key properties of methyl (2S)-2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoate?
methyl (2S)-2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoate has a molecular weight of 225.17 g/mol, XLogP of 0.78, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoate is sourced from PubChem (CID 135006947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).