C22H20Cl2N2O — CID 58639665
N-(4-tert-butylphenyl)-5-chloro-6-(2-chlorophenyl)pyridine-3-carboxamide (PubChem CID 58639665) has the molecular formula C22H20Cl2N2O and a molecular weight of 399.32 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-5-chloro-6-(2-chlorophenyl)pyridine-3-carboxamide.
| Compound Name | N-(4-tert-butylphenyl)-5-chloro-6-(2-chlorophenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 58639665 |
| Molecular Formula | C22H20Cl2N2O |
| Molecular Weight | 399.32 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | N-(4-tert-butylphenyl)-5-chloro-6-(2-chlorophenyl)pyridine-3-carboxamide |
| SMILES | CC(C)(C)c1ccc(NC(=O)c2cnc(-c3ccccc3Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C22H20Cl2N2O/c1-22(2,3)15-8-10-16(11-9-15)26-21(27)14-12-19(24)20(25-13-14)17-6-4-5-7-18(17)23/h4-13H,1-3H3,(H,26,27) |
| InChIKey | REBGVYVIDSRHFH-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.32 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |