C23H15Cl2N3O — CID 10310004
5,6-bis(2-chlorophenyl)-N-phenylpyrazine-2-carboxamide (PubChem CID 10310004) has the molecular formula C23H15Cl2N3O and a molecular weight of 420.30 g/mol. Its IUPAC name is 5,6-bis(2-chlorophenyl)-N-phenylpyrazine-2-carboxamide.
| Compound Name | 5,6-bis(2-chlorophenyl)-N-phenylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 10310004 |
| Molecular Formula | C23H15Cl2N3O |
| Molecular Weight | 420.30 g/mol |
| Exact Mass | 419.06 |
| IUPAC Name | 5,6-bis(2-chlorophenyl)-N-phenylpyrazine-2-carboxamide |
| SMILES | O=C(Nc1ccccc1)c1cnc(-c2ccccc2Cl)c(-c2ccccc2Cl)n1 |
| InChI | InChI=1S/C23H15Cl2N3O/c24-18-12-6-4-10-16(18)21-22(17-11-5-7-13-19(17)25)28-20(14-26-21)23(29)27-15-8-2-1-3-9-15/h1-14H,(H,27,29) |
| InChIKey | OTQMQCJNTMMDQF-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.30 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |