C27H33N5O5 — CID 58640088
N-[(2S)-1-[(3aR,6aS)-4-(1-oxidopyridin-1-ium-4-carbonyl)-6-oxo-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]-4-methyl-1-oxopentan-2-yl]-4-(dimethylamino)benzamide (PubChem CID 58640088) has the molecular formula C27H33N5O5 and a molecular weight of 507.59 g/mol. Its IUPAC name is N-[(2S)-1-[(3aR,6aS)-4-(1-oxidopyridin-1-ium-4-carbonyl)-6-oxo-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]-4-methyl-1-oxopentan-2-yl]-4-(dimethylamino)benzamide.
| Compound Name | N-[(2S)-1-[(3aR,6aS)-4-(1-oxidopyridin-1-ium-4-carbonyl)-6-oxo-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]-4-methyl-1-oxopentan-2-yl]-4-(dimethylamino)benzamide |
|---|---|
| PubChem CID | 58640088 |
| Molecular Formula | C27H33N5O5 |
| Molecular Weight | 507.59 g/mol |
| Exact Mass | 507.25 |
| IUPAC Name | N-[(2S)-1-[(3aR,6aS)-4-(1-oxidopyridin-1-ium-4-carbonyl)-6-oxo-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]-4-methyl-1-oxopentan-2-yl]-4-(dimethylamino)benzamide |
| SMILES | CC(C)C[C@H](NC(=O)c1ccc(N(C)C)cc1)C(=O)N1CC[C@@H]2[C@H]1C(=O)CN2C(=O)c1cc[n+]([O-])cc1 |
| InChI | InChI=1S/C27H33N5O5/c1-17(2)15-21(28-25(34)18-5-7-20(8-6-18)29(3)4)27(36)31-14-11-22-24(31)23(33)16-32(22)26(35)19-9-12-30(37)13-10-19/h5-10,12-13,17,21-22,24H,11,14-16H2,1-4H3,(H,28,34)/t21-,22+,24-/m0/s1 |
| InChIKey | SAFWISUQRSBKIF-ZDXQCDESSA-N |
| XLogP | 1.23 |
| TPSA | 116.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.59 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|