C27H33N5O4 — CID 68961066
N-[(2S)-1-[(6aS)-6-oxo-4-(pyridine-3-carbonyl)-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]-4-methyl-1-oxopentan-2-yl]-4-(dimethylamino)benzamide (PubChem CID 68961066) has the molecular formula C27H33N5O4 and a molecular weight of 491.59 g/mol. Its IUPAC name is N-[(2S)-1-[(6aS)-6-oxo-4-(pyridine-3-carbonyl)-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]-4-methyl-1-oxopentan-2-yl]-4-(dimethylamino)benzamide.
| Compound Name | N-[(2S)-1-[(6aS)-6-oxo-4-(pyridine-3-carbonyl)-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]-4-methyl-1-oxopentan-2-yl]-4-(dimethylamino)benzamide |
|---|---|
| PubChem CID | 68961066 |
| Molecular Formula | C27H33N5O4 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.25 |
| IUPAC Name | N-[(2S)-1-[(6aS)-6-oxo-4-(pyridine-3-carbonyl)-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]-4-methyl-1-oxopentan-2-yl]-4-(dimethylamino)benzamide |
| SMILES | CC(C)C[C@H](NC(=O)c1ccc(N(C)C)cc1)C(=O)N1CCC2[C@H]1C(=O)CN2C(=O)c1cccnc1 |
| InChI | InChI=1S/C27H33N5O4/c1-17(2)14-21(29-25(34)18-7-9-20(10-8-18)30(3)4)27(36)31-13-11-22-24(31)23(33)16-32(22)26(35)19-6-5-12-28-15-19/h5-10,12,15,17,21-22,24H,11,13-14,16H2,1-4H3,(H,29,34)/t21-,22?,24-/m0/s1 |
| InChIKey | ZANUJDUYTCEWDG-WKJLPXBYSA-N |
| XLogP | 1.99 |
| TPSA | 102.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |