C31H33N3O4S — CID 58640193
N-[(2S)-1-[(3aR,6aS)-4-benzoyl-6-oxo-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]-3-cyclohexyl-1-oxopropan-2-yl]-1-benzothiophene-3-carboxamide (PubChem CID 58640193) has the molecular formula C31H33N3O4S and a molecular weight of 543.69 g/mol. Its IUPAC name is N-[(2S)-1-[(3aR,6aS)-4-benzoyl-6-oxo-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]-3-cyclohexyl-1-oxopropan-2-yl]-1-benzothiophene-3-carboxamide.
| Compound Name | N-[(2S)-1-[(3aR,6aS)-4-benzoyl-6-oxo-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]-3-cyclohexyl-1-oxopropan-2-yl]-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 58640193 |
| Molecular Formula | C31H33N3O4S |
| Molecular Weight | 543.69 g/mol |
| Exact Mass | 543.22 |
| IUPAC Name | N-[(2S)-1-[(3aR,6aS)-4-benzoyl-6-oxo-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]-3-cyclohexyl-1-oxopropan-2-yl]-1-benzothiophene-3-carboxamide |
| SMILES | O=C(N[C@@H](CC1CCCCC1)C(=O)N1CC[C@@H]2[C@H]1C(=O)CN2C(=O)c1ccccc1)c1csc2ccccc12 |
| InChI | InChI=1S/C31H33N3O4S/c35-26-18-34(30(37)21-11-5-2-6-12-21)25-15-16-33(28(25)26)31(38)24(17-20-9-3-1-4-10-20)32-29(36)23-19-39-27-14-8-7-13-22(23)27/h2,5-8,11-14,19-20,24-25,28H,1,3-4,9-10,15-18H2,(H,32,36)/t24-,25+,28-/m0/s1 |
| InChIKey | BFRYFSVPTPKTHA-OARDWFSCSA-N |
| XLogP | 4.66 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.69 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |