C23H16Cl2N2O3S2 — CID 58643212
(5Z)-5-[[3-(2,4-dichlorophenyl)-5-methoxy-4-(pyridin-2-ylmethoxy)phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 58643212) has the molecular formula C23H16Cl2N2O3S2 and a molecular weight of 503.43 g/mol. Its IUPAC name is (5Z)-5-[[3-(2,4-dichlorophenyl)-5-methoxy-4-(pyridin-2-ylmethoxy)phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[3-(2,4-dichlorophenyl)-5-methoxy-4-(pyridin-2-ylmethoxy)phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 58643212 |
| Molecular Formula | C23H16Cl2N2O3S2 |
| Molecular Weight | 503.43 g/mol |
| Exact Mass | 502.00 |
| IUPAC Name | (5Z)-5-[[3-(2,4-dichlorophenyl)-5-methoxy-4-(pyridin-2-ylmethoxy)phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COc1cc(/C=C2\SC(=S)NC2=O)cc(-c2ccc(Cl)cc2Cl)c1OCc1ccccn1 |
| InChI | InChI=1S/C23H16Cl2N2O3S2/c1-29-19-9-13(10-20-22(28)27-23(31)32-20)8-17(16-6-5-14(24)11-18(16)25)21(19)30-12-15-4-2-3-7-26-15/h2-11H,12H2,1H3,(H,27,28,31)/b20-10- |
| InChIKey | PNXAIRYNJMPSLT-JMIUGGIZSA-N |
| XLogP | 6.13 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.43 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|