C22H15F3N2O3S2 — CID 58643396
(5Z)-5-[[4-methoxy-3-[6-methyl-4-oxo-2-(trifluoromethyl)-1H-quinolin-7-yl]phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 58643396) has the molecular formula C22H15F3N2O3S2 and a molecular weight of 476.50 g/mol. Its IUPAC name is (5Z)-5-[[4-methoxy-3-[6-methyl-4-oxo-2-(trifluoromethyl)-1H-quinolin-7-yl]phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[4-methoxy-3-[6-methyl-4-oxo-2-(trifluoromethyl)-1H-quinolin-7-yl]phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 58643396 |
| Molecular Formula | C22H15F3N2O3S2 |
| Molecular Weight | 476.50 g/mol |
| Exact Mass | 476.05 |
| IUPAC Name | (5Z)-5-[[4-methoxy-3-[6-methyl-4-oxo-2-(trifluoromethyl)-1H-quinolin-7-yl]phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(/C=C2\SC(=S)NC2=O)cc1-c1cc2[nH]c(C(F)(F)F)cc(=O)c2cc1C |
| InChI | InChI=1S/C22H15F3N2O3S2/c1-10-5-14-15(26-19(9-16(14)28)22(23,24)25)8-12(10)13-6-11(3-4-17(13)30-2)7-18-20(29)27-21(31)32-18/h3-9H,1-2H3,(H,26,28)(H,27,29,31)/b18-7- |
| InChIKey | IJYYKULWYAJYDS-WSVATBPTSA-N |
| XLogP | 5.02 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.50 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|